C15H22N2 — CID 102814225
[3-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)phenyl]methanamine (PubChem CID 102814225) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is [3-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)phenyl]methanamine.
| Compound Name | [3-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 102814225 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | [3-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)phenyl]methanamine |
| SMILES | NCc1cccc(N2CCC3CCCCC32)c1 |
| InChI | InChI=1S/C15H22N2/c16-11-12-4-3-6-14(10-12)17-9-8-13-5-1-2-7-15(13)17/h3-4,6,10,13,15H,1-2,5,7-9,11,16H2 |
| InChIKey | URUVYFLXFJXYQM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |