C15H18N2O — CID 102814568
[3-(3-pyridin-4-ylpropoxy)phenyl]methanamine (PubChem CID 102814568) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is [3-(3-pyridin-4-ylpropoxy)phenyl]methanamine.
| Compound Name | [3-(3-pyridin-4-ylpropoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 102814568 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | [3-(3-pyridin-4-ylpropoxy)phenyl]methanamine |
| SMILES | NCc1cccc(OCCCc2ccncc2)c1 |
| InChI | InChI=1S/C15H18N2O/c16-12-14-3-1-5-15(11-14)18-10-2-4-13-6-8-17-9-7-13/h1,3,5-9,11H,2,4,10,12,16H2 |
| InChIKey | NWOQOIVYSUFALI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|