C11H10BrF3N2 — CID 102816684
3-bromo-5-[methyl(3,3,3-trifluoropropyl)amino]benzonitrile (PubChem CID 102816684) has the molecular formula C11H10BrF3N2 and a molecular weight of 307.11 g/mol. Its IUPAC name is 3-bromo-5-[methyl(3,3,3-trifluoropropyl)amino]benzonitrile.
| Compound Name | 3-bromo-5-[methyl(3,3,3-trifluoropropyl)amino]benzonitrile |
|---|---|
| PubChem CID | 102816684 |
| Molecular Formula | C11H10BrF3N2 |
| Molecular Weight | 307.11 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 3-bromo-5-[methyl(3,3,3-trifluoropropyl)amino]benzonitrile |
| SMILES | CN(CCC(F)(F)F)c1cc(Br)cc(C#N)c1 |
| InChI | InChI=1S/C11H10BrF3N2/c1-17(3-2-11(13,14)15)10-5-8(7-16)4-9(12)6-10/h4-6H,2-3H2,1H3 |
| InChIKey | OPIQDDWSVNDMMJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.11 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |