C17H23FN2 — CID 102817183
3-fluoro-5-[(3,3,5,5-tetramethylcyclohexyl)amino]benzonitrile (PubChem CID 102817183) has the molecular formula C17H23FN2 and a molecular weight of 274.38 g/mol. Its IUPAC name is 3-fluoro-5-[(3,3,5,5-tetramethylcyclohexyl)amino]benzonitrile.
| Compound Name | 3-fluoro-5-[(3,3,5,5-tetramethylcyclohexyl)amino]benzonitrile |
|---|---|
| PubChem CID | 102817183 |
| Molecular Formula | C17H23FN2 |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 3-fluoro-5-[(3,3,5,5-tetramethylcyclohexyl)amino]benzonitrile |
| SMILES | CC1(C)CC(Nc2cc(F)cc(C#N)c2)CC(C)(C)C1 |
| InChI | InChI=1S/C17H23FN2/c1-16(2)8-15(9-17(3,4)11-16)20-14-6-12(10-19)5-13(18)7-14/h5-7,15,20H,8-9,11H2,1-4H3 |
| InChIKey | GRHLBOIMZYYUCQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |