About 3-fluoro-5-(1,3-thiazol-5-ylmethylamino)benzonitrile
3-fluoro-5-(1,3-thiazol-5-ylmethylamino)benzonitrile (PubChem CID 102817474) has the molecular formula C11H8FN3S
and a molecular weight of 233.27 g/mol. Its IUPAC name is 3-fluoro-5-(1,3-thiazol-5-ylmethylamino)benzonitrile.
Molecular Properties
| Compound Name | 3-fluoro-5-(1,3-thiazol-5-ylmethylamino)benzonitrile |
| PubChem CID | 102817474 |
| Molecular Formula | C11H8FN3S |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 3-fluoro-5-(1,3-thiazol-5-ylmethylamino)benzonitrile |
| SMILES | N#Cc1cc(F)cc(NCc2cncs2)c1 |
| InChI | InChI=1S/C11H8FN3S/c12-9-1-8(4-13)2-10(3-9)15-6-11-5-14-7-16-11/h1-3,5,7,15H,6H2 |
| InChIKey | XFLWVTPOUHMNTH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-fluoro-5-(1,3-thiazol-5-ylmethylamino)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-5-(1,3-thiazol-5-ylmethylamino)benzonitrile?
The IUPAC name of 3-fluoro-5-(1,3-thiazol-5-ylmethylamino)benzonitrile (CID 102817474) is 3-fluoro-5-(1,3-thiazol-5-ylmethylamino)benzonitrile.
What is the SMILES notation for 3-fluoro-5-(1,3-thiazol-5-ylmethylamino)benzonitrile?
The canonical SMILES for 3-fluoro-5-(1,3-thiazol-5-ylmethylamino)benzonitrile is N#Cc1cc(F)cc(NCc2cncs2)c1.
What is the InChIKey of 3-fluoro-5-(1,3-thiazol-5-ylmethylamino)benzonitrile?
The InChIKey is XFLWVTPOUHMNTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8FN3S/c12-9-1-8(4-13)2-10(3-9)15-6-11-5-14-7-16-11/h1-3,5,7,15H,6H2.
What are the key properties of 3-fluoro-5-(1,3-thiazol-5-ylmethylamino)benzonitrile?
3-fluoro-5-(1,3-thiazol-5-ylmethylamino)benzonitrile has a molecular weight of 233.27 g/mol, XLogP of 2.77, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-5-(1,3-thiazol-5-ylmethylamino)benzonitrile is sourced from PubChem (CID 102817474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).