C10H5N5 — CID 102817654
1-(3-cyanophenyl)-1,2,4-triazole-3-carbonitrile (PubChem CID 102817654) has the molecular formula C10H5N5 and a molecular weight of 195.18 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-1,2,4-triazole-3-carbonitrile.
| Compound Name | 1-(3-cyanophenyl)-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 102817654 |
| Molecular Formula | C10H5N5 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 1-(3-cyanophenyl)-1,2,4-triazole-3-carbonitrile |
| SMILES | N#Cc1cccc(-n2cnc(C#N)n2)c1 |
| InChI | InChI=1S/C10H5N5/c11-5-8-2-1-3-9(4-8)15-7-13-10(6-12)14-15/h1-4,7H |
| InChIKey | SUQXFSLEIWZBMN-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 78.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |