C15H12FNO — CID 102817820
3-(3,5-dimethylphenoxy)-5-fluorobenzonitrile (PubChem CID 102817820) has the molecular formula C15H12FNO and a molecular weight of 241.26 g/mol. Its IUPAC name is 3-(3,5-dimethylphenoxy)-5-fluorobenzonitrile.
| Compound Name | 3-(3,5-dimethylphenoxy)-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 102817820 |
| Molecular Formula | C15H12FNO |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 3-(3,5-dimethylphenoxy)-5-fluorobenzonitrile |
| SMILES | Cc1cc(C)cc(Oc2cc(F)cc(C#N)c2)c1 |
| InChI | InChI=1S/C15H12FNO/c1-10-3-11(2)5-14(4-10)18-15-7-12(9-17)6-13(16)8-15/h3-8H,1-2H3 |
| InChIKey | NJTYWMIJYZKPFL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |