C33H26ClNO7 — CID 10281827
5-[[4-(2-chlorophenyl)phenyl]methyl-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]benzene-1,2,4-tricarboxylic acid (PubChem CID 10281827) has the molecular formula C33H26ClNO7 and a molecular weight of 584.02 g/mol. Its IUPAC name is 5-[[4-(2-chlorophenyl)phenyl]methyl-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]benzene-1,2,4-tricarboxylic acid.
| Compound Name | 5-[[4-(2-chlorophenyl)phenyl]methyl-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]benzene-1,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 10281827 |
| Molecular Formula | C33H26ClNO7 |
| Molecular Weight | 584.02 g/mol |
| Exact Mass | 583.14 |
| IUPAC Name | 5-[[4-(2-chlorophenyl)phenyl]methyl-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]carbamoyl]benzene-1,2,4-tricarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)c(C(=O)N(Cc2ccc(-c3ccccc3Cl)cc2)[C@H]2CCCc3ccccc32)cc1C(=O)O |
| InChI | InChI=1S/C33H26ClNO7/c34-28-10-4-3-8-22(28)21-14-12-19(13-15-21)18-35(29-11-5-7-20-6-1-2-9-23(20)29)30(36)24-16-26(32(39)40)27(33(41)42)17-25(24)31(37)38/h1-4,6,8-10,12-17,29H,5,7,11,18H2,(H,37,38)(H,39,40)(H,41,42)/t29-/m0/s1 |
| InChIKey | FRVLEGQURZGIEX-LJAQVGFWSA-N |
| XLogP | 6.82 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.02 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |