C31H48F3NO6 — CID 10281909
[8-[7-(butylamino)-3-hydroxy-7-oxo-5-(2,2,2-trifluoroacetyl)oxyheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 10281909) has the molecular formula C31H48F3NO6 and a molecular weight of 587.72 g/mol. Its IUPAC name is [8-[7-(butylamino)-3-hydroxy-7-oxo-5-(2,2,2-trifluoroacetyl)oxyheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [8-[7-(butylamino)-3-hydroxy-7-oxo-5-(2,2,2-trifluoroacetyl)oxyheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 10281909 |
| Molecular Formula | C31H48F3NO6 |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.34 |
| IUPAC Name | [8-[7-(butylamino)-3-hydroxy-7-oxo-5-(2,2,2-trifluoroacetyl)oxyheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCCCNC(=O)CC(CC(O)CCC1C(C)C=CC2=CC(C)CC(OC(=O)C(C)(C)CC)C21)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C31H48F3NO6/c1-7-9-14-35-26(37)18-23(40-29(39)31(32,33)34)17-22(36)12-13-24-20(4)10-11-21-15-19(3)16-25(27(21)24)41-28(38)30(5,6)8-2/h10-11,15,19-20,22-25,27,36H,7-9,12-14,16-18H2,1-6H3,(H,35,37) |
| InChIKey | SQYOCCFJWYOARZ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|