C28H26N4O7S2 — CID 10282068
1-cyclopropyl-7-[4-(1,3-dihydro-2,1,3-benzoxadiazol-4-ylsulfonylamino)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-8-methoxy-4-oxoquinoline-3-carboxylic acid (PubChem CID 10282068) has the molecular formula C28H26N4O7S2 and a molecular weight of 594.67 g/mol. Its IUPAC name is 1-cyclopropyl-7-[4-(1,3-dihydro-2,1,3-benzoxadiazol-4-ylsulfonylamino)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-8-methoxy-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-7-[4-(1,3-dihydro-2,1,3-benzoxadiazol-4-ylsulfonylamino)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-8-methoxy-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 10282068 |
| Molecular Formula | C28H26N4O7S2 |
| Molecular Weight | 594.67 g/mol |
| Exact Mass | 594.12 |
| IUPAC Name | 1-cyclopropyl-7-[4-(1,3-dihydro-2,1,3-benzoxadiazol-4-ylsulfonylamino)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-8-methoxy-4-oxoquinoline-3-carboxylic acid |
| SMILES | COc1c(-c2cc3c(s2)CCCC3NS(=O)(=O)c2cccc3c2NON3)ccc2c(=O)c(C(=O)O)cn(C3CC3)c12 |
| InChI | InChI=1S/C28H26N4O7S2/c1-38-27-15(10-11-16-25(27)32(14-8-9-14)13-18(26(16)33)28(34)35)22-12-17-19(4-2-6-21(17)40-22)31-41(36,37)23-7-3-5-20-24(23)30-39-29-20/h3,5,7,10-14,19,29-31H,2,4,6,8-9H2,1H3,(H,34,35) |
| InChIKey | XFMNDWCBEKUBTA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 147.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.67 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |