C30H31ClN4O5S — CID 10282075
(3Z)-N-(3-chlorophenyl)-3-[1-[5-(2-morpholin-4-ylethoxy)-2,3-dihydro-1H-indol-2-yl]ethylidene]-2-oxo-1H-indole-5-sulfonamide (PubChem CID 10282075) has the molecular formula C30H31ClN4O5S and a molecular weight of 595.12 g/mol. Its IUPAC name is (3Z)-N-(3-chlorophenyl)-3-[1-[5-(2-morpholin-4-ylethoxy)-2,3-dihydro-1H-indol-2-yl]ethylidene]-2-oxo-1H-indole-5-sulfonamide.
| Compound Name | (3Z)-N-(3-chlorophenyl)-3-[1-[5-(2-morpholin-4-ylethoxy)-2,3-dihydro-1H-indol-2-yl]ethylidene]-2-oxo-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 10282075 |
| Molecular Formula | C30H31ClN4O5S |
| Molecular Weight | 595.12 g/mol |
| Exact Mass | 594.17 |
| IUPAC Name | (3Z)-N-(3-chlorophenyl)-3-[1-[5-(2-morpholin-4-ylethoxy)-2,3-dihydro-1H-indol-2-yl]ethylidene]-2-oxo-1H-indole-5-sulfonamide |
| SMILES | C/C(=C1/C(=O)Nc2ccc(S(=O)(=O)Nc3cccc(Cl)c3)cc21)C1Cc2cc(OCCN3CCOCC3)ccc2N1 |
| InChI | InChI=1S/C30H31ClN4O5S/c1-19(28-16-20-15-23(5-7-26(20)32-28)40-14-11-35-9-12-39-13-10-35)29-25-18-24(6-8-27(25)33-30(29)36)41(37,38)34-22-4-2-3-21(31)17-22/h2-8,15,17-18,28,32,34H,9-14,16H2,1H3,(H,33,36)/b29-19- |
| InChIKey | JLBUHDUJNUXAHO-CEUNXORHSA-N |
| XLogP | 4.61 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.12 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|