C11H6Cl4N2 — CID 102821923
4-(2,3,5,6-tetrachlorophenyl)pyridin-2-amine (PubChem CID 102821923) has the molecular formula C11H6Cl4N2 and a molecular weight of 308.00 g/mol. Its IUPAC name is 4-(2,3,5,6-tetrachlorophenyl)pyridin-2-amine.
| Compound Name | 4-(2,3,5,6-tetrachlorophenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102821923 |
| Molecular Formula | C11H6Cl4N2 |
| Molecular Weight | 308.00 g/mol |
| Exact Mass | 305.93 |
| IUPAC Name | 4-(2,3,5,6-tetrachlorophenyl)pyridin-2-amine |
| SMILES | Nc1cc(-c2c(Cl)c(Cl)cc(Cl)c2Cl)ccn1 |
| InChI | InChI=1S/C11H6Cl4N2/c12-6-4-7(13)11(15)9(10(6)14)5-1-2-17-8(16)3-5/h1-4H,(H2,16,17) |
| InChIKey | WYJMVPHEHNLIJP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.00 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|