C12H14N2O4S — CID 102822206
(E)-3-[2-(1,1-dioxothiazinan-2-yl)-4-pyridinyl]prop-2-enoic acid (PubChem CID 102822206) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is (E)-3-[2-(1,1-dioxothiazinan-2-yl)-4-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(1,1-dioxothiazinan-2-yl)-4-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 102822206 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | (E)-3-[2-(1,1-dioxothiazinan-2-yl)-4-pyridinyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccnc(N2CCCCS2(=O)=O)c1 |
| InChI | InChI=1S/C12H14N2O4S/c15-12(16)4-3-10-5-6-13-11(9-10)14-7-1-2-8-19(14,17)18/h3-6,9H,1-2,7-8H2,(H,15,16)/b4-3+ |
| InChIKey | JNLCMVMKIDCBKA-ONEGZZNKSA-N |
| XLogP | 1.11 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|