C37H41N5O3 — CID 10282272
N-[1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-6-[1-(4-tert-butylphenyl)-3-isoquinolin-3-ylpyrazol-5-yl]hexanamide (PubChem CID 10282272) has the molecular formula C37H41N5O3 and a molecular weight of 603.77 g/mol. Its IUPAC name is N-[1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-6-[1-(4-tert-butylphenyl)-3-isoquinolin-3-ylpyrazol-5-yl]hexanamide.
| Compound Name | N-[1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-6-[1-(4-tert-butylphenyl)-3-isoquinolin-3-ylpyrazol-5-yl]hexanamide |
|---|---|
| PubChem CID | 10282272 |
| Molecular Formula | C37H41N5O3 |
| Molecular Weight | 603.77 g/mol |
| Exact Mass | 603.32 |
| IUPAC Name | N-[1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-6-[1-(4-tert-butylphenyl)-3-isoquinolin-3-ylpyrazol-5-yl]hexanamide |
| SMILES | CC(C)(C)c1ccc(-n2nc(-c3cc4ccccc4cn3)cc2CCCCCC(=O)NC(Cc2ccc(O)cc2)C(N)=O)cc1 |
| InChI | InChI=1S/C37H41N5O3/c1-37(2,3)28-15-17-29(18-16-28)42-30(23-33(41-42)32-22-26-9-7-8-10-27(26)24-39-32)11-5-4-6-12-35(44)40-34(36(38)45)21-25-13-19-31(43)20-14-25/h7-10,13-20,22-24,34,43H,4-6,11-12,21H2,1-3H3,(H2,38,45)(H,40,44) |
| InChIKey | NWYPBTOYMHTIQD-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.77 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|