C35H48N4O5 — CID 10282293
N-[1-[[6-amino-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxohexan-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]tricyclo[3.3.1.03,7]nonane-3-carboxamide (PubChem CID 10282293) has the molecular formula C35H48N4O5 and a molecular weight of 604.79 g/mol. Its IUPAC name is N-[1-[[6-amino-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxohexan-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]tricyclo[3.3.1.03,7]nonane-3-carboxamide.
| Compound Name | N-[1-[[6-amino-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxohexan-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]tricyclo[3.3.1.03,7]nonane-3-carboxamide |
|---|---|
| PubChem CID | 10282293 |
| Molecular Formula | C35H48N4O5 |
| Molecular Weight | 604.79 g/mol |
| Exact Mass | 604.36 |
| IUPAC Name | N-[1-[[6-amino-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxohexan-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]tricyclo[3.3.1.03,7]nonane-3-carboxamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)C(CCCCN)NC(=O)C(CC3CCCCC3)NC(=O)C34CC5CC(CC3C5)C4)ccc12 |
| InChI | InChI=1S/C35H48N4O5/c1-21-13-31(40)44-30-18-26(10-11-27(21)30)37-32(41)28(9-5-6-12-36)38-33(42)29(17-22-7-3-2-4-8-22)39-34(43)35-19-23-14-24(20-35)16-25(35)15-23/h10-11,13,18,22-25,28-29H,2-9,12,14-17,19-20,36H2,1H3,(H,37,41)(H,38,42)(H,39,43) |
| InChIKey | PJQOTTPJQQPZQS-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.79 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|