C14H20N2O2 — CID 102823229
3-(2-pyrrolidin-1-ylpropylamino)benzoic acid (PubChem CID 102823229) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 3-(2-pyrrolidin-1-ylpropylamino)benzoic acid.
| Compound Name | 3-(2-pyrrolidin-1-ylpropylamino)benzoic acid |
|---|---|
| PubChem CID | 102823229 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 3-(2-pyrrolidin-1-ylpropylamino)benzoic acid |
| SMILES | CC(CNc1cccc(C(=O)O)c1)N1CCCC1 |
| InChI | InChI=1S/C14H20N2O2/c1-11(16-7-2-3-8-16)10-15-13-6-4-5-12(9-13)14(17)18/h4-6,9,11,15H,2-3,7-8,10H2,1H3,(H,17,18) |
| InChIKey | CZEOQFUAZGWXCY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |