C13H13BrN2O2S — CID 102823310
3-bromo-5-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]benzoic acid (PubChem CID 102823310) has the molecular formula C13H13BrN2O2S and a molecular weight of 341.23 g/mol. Its IUPAC name is 3-bromo-5-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]benzoic acid.
| Compound Name | 3-bromo-5-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 102823310 |
| Molecular Formula | C13H13BrN2O2S |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 3-bromo-5-[1-(5-methyl-1,3-thiazol-2-yl)ethylamino]benzoic acid |
| SMILES | Cc1cnc(C(C)Nc2cc(Br)cc(C(=O)O)c2)s1 |
| InChI | InChI=1S/C13H13BrN2O2S/c1-7-6-15-12(19-7)8(2)16-11-4-9(13(17)18)3-10(14)5-11/h3-6,8,16H,1-2H3,(H,17,18) |
| InChIKey | XPSSMFYNGBHXSR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |