C39H51N3O3 — CID 10282400
[1-[8-(4-benzoylpiperidin-1-yl)octyl]-4-methylpiperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 10282400) has the molecular formula C39H51N3O3 and a molecular weight of 609.86 g/mol. Its IUPAC name is [1-[8-(4-benzoylpiperidin-1-yl)octyl]-4-methylpiperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[8-(4-benzoylpiperidin-1-yl)octyl]-4-methylpiperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 10282400 |
| Molecular Formula | C39H51N3O3 |
| Molecular Weight | 609.86 g/mol |
| Exact Mass | 609.39 |
| IUPAC Name | [1-[8-(4-benzoylpiperidin-1-yl)octyl]-4-methylpiperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | CC1(OC(=O)Nc2ccccc2-c2ccccc2)CCN(CCCCCCCCN2CCC(C(=O)c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C39H51N3O3/c1-39(45-38(44)40-36-21-13-12-20-35(36)32-16-8-6-9-17-32)24-30-42(31-25-39)27-15-5-3-2-4-14-26-41-28-22-34(23-29-41)37(43)33-18-10-7-11-19-33/h6-13,16-21,34H,2-5,14-15,22-31H2,1H3,(H,40,44) |
| InChIKey | HQDWQZAIQDYLRR-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.86 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|