C11H16ClN3O — CID 102824069
2-[(2-chloro-4-pyridinyl)-ethylamino]-N,N-dimethylacetamide (PubChem CID 102824069) has the molecular formula C11H16ClN3O and a molecular weight of 241.72 g/mol. Its IUPAC name is 2-[(2-chloro-4-pyridinyl)-ethylamino]-N,N-dimethylacetamide.
| Compound Name | 2-[(2-chloro-4-pyridinyl)-ethylamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 102824069 |
| Molecular Formula | C11H16ClN3O |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-[(2-chloro-4-pyridinyl)-ethylamino]-N,N-dimethylacetamide |
| SMILES | CCN(CC(=O)N(C)C)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C11H16ClN3O/c1-4-15(8-11(16)14(2)3)9-5-6-13-10(12)7-9/h5-7H,4,8H2,1-3H3 |
| InChIKey | AOESWINVEMWFSC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|