C16H20N2 — CID 102824812
N-ethyl-2-(2,4,5-trimethylphenyl)pyridin-4-amine (PubChem CID 102824812) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is N-ethyl-2-(2,4,5-trimethylphenyl)pyridin-4-amine.
| Compound Name | N-ethyl-2-(2,4,5-trimethylphenyl)pyridin-4-amine |
|---|---|
| PubChem CID | 102824812 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | N-ethyl-2-(2,4,5-trimethylphenyl)pyridin-4-amine |
| SMILES | CCNc1ccnc(-c2cc(C)c(C)cc2C)c1 |
| InChI | InChI=1S/C16H20N2/c1-5-17-14-6-7-18-16(10-14)15-9-12(3)11(2)8-13(15)4/h6-10H,5H2,1-4H3,(H,17,18) |
| InChIKey | NKYOHCYBMFSVMJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |