C11H21N5O3S — CID 102825420
2-[5-amino-4-methylsulfonyl-3-(piperidin-4-ylamino)pyrazol-1-yl]ethanol (PubChem CID 102825420) has the molecular formula C11H21N5O3S and a molecular weight of 303.39 g/mol. Its IUPAC name is 2-[5-amino-4-methylsulfonyl-3-(piperidin-4-ylamino)pyrazol-1-yl]ethanol.
| Compound Name | 2-[5-amino-4-methylsulfonyl-3-(piperidin-4-ylamino)pyrazol-1-yl]ethanol |
|---|---|
| PubChem CID | 102825420 |
| Molecular Formula | C11H21N5O3S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2-[5-amino-4-methylsulfonyl-3-(piperidin-4-ylamino)pyrazol-1-yl]ethanol |
| SMILES | CS(=O)(=O)c1c(NC2CCNCC2)nn(CCO)c1N |
| InChI | InChI=1S/C11H21N5O3S/c1-20(18,19)9-10(12)16(6-7-17)15-11(9)14-8-2-4-13-5-3-8/h8,13,17H,2-7,12H2,1H3,(H,14,15) |
| InChIKey | QNUPIKZFAAYUBB-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |