C33H45F2N3O6 — CID 10282555
5-[[(2R,4S,5S)-6-(3,5-difluorophenyl)-5-[[3-(dipropylcarbamoyl)benzoyl]amino]-2-ethyl-4-hydroxyhexanoyl]amino]pentanoic acid (PubChem CID 10282555) has the molecular formula C33H45F2N3O6 and a molecular weight of 617.73 g/mol. Its IUPAC name is 5-[[(2R,4S,5S)-6-(3,5-difluorophenyl)-5-[[3-(dipropylcarbamoyl)benzoyl]amino]-2-ethyl-4-hydroxyhexanoyl]amino]pentanoic acid.
| Compound Name | 5-[[(2R,4S,5S)-6-(3,5-difluorophenyl)-5-[[3-(dipropylcarbamoyl)benzoyl]amino]-2-ethyl-4-hydroxyhexanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 10282555 |
| Molecular Formula | C33H45F2N3O6 |
| Molecular Weight | 617.73 g/mol |
| Exact Mass | 617.33 |
| IUPAC Name | 5-[[(2R,4S,5S)-6-(3,5-difluorophenyl)-5-[[3-(dipropylcarbamoyl)benzoyl]amino]-2-ethyl-4-hydroxyhexanoyl]amino]pentanoic acid |
| SMILES | CCCN(CCC)C(=O)c1cccc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@@H](O)C[C@@H](CC)C(=O)NCCCCC(=O)O)c1 |
| InChI | InChI=1S/C33H45F2N3O6/c1-4-14-38(15-5-2)33(44)25-11-9-10-24(19-25)32(43)37-28(18-22-16-26(34)21-27(35)17-22)29(39)20-23(6-3)31(42)36-13-8-7-12-30(40)41/h9-11,16-17,19,21,23,28-29,39H,4-8,12-15,18,20H2,1-3H3,(H,36,42)(H,37,43)(H,40,41)/t23-,28+,29+/m1/s1 |
| InChIKey | ZKWKVFUBEDCLBE-MGONOCMRSA-N |
| XLogP | 4.72 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.73 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|