C10H17N5O2S — CID 102825730
3-[5-amino-4-methylsulfonyl-3-(propylamino)pyrazol-1-yl]propanenitrile (PubChem CID 102825730) has the molecular formula C10H17N5O2S and a molecular weight of 271.35 g/mol. Its IUPAC name is 3-[5-amino-4-methylsulfonyl-3-(propylamino)pyrazol-1-yl]propanenitrile.
| Compound Name | 3-[5-amino-4-methylsulfonyl-3-(propylamino)pyrazol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 102825730 |
| Molecular Formula | C10H17N5O2S |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 3-[5-amino-4-methylsulfonyl-3-(propylamino)pyrazol-1-yl]propanenitrile |
| SMILES | CCCNc1nn(CCC#N)c(N)c1S(C)(=O)=O |
| InChI | InChI=1S/C10H17N5O2S/c1-3-6-13-10-8(18(2,16)17)9(12)15(14-10)7-4-5-11/h3-4,6-7,12H2,1-2H3,(H,13,14) |
| InChIKey | DIFZKGLPSYZYTP-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 113.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |