C31H29F4N3O7 — CID 10282793
(3S)-3-[[(2S)-2-[[2-(benzhydrylamino)-2-oxoacetyl]amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid (PubChem CID 10282793) has the molecular formula C31H29F4N3O7 and a molecular weight of 631.58 g/mol. Its IUPAC name is (3S)-3-[[(2S)-2-[[2-(benzhydrylamino)-2-oxoacetyl]amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid.
| Compound Name | (3S)-3-[[(2S)-2-[[2-(benzhydrylamino)-2-oxoacetyl]amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
|---|---|
| PubChem CID | 10282793 |
| Molecular Formula | C31H29F4N3O7 |
| Molecular Weight | 631.58 g/mol |
| Exact Mass | 631.19 |
| IUPAC Name | (3S)-3-[[(2S)-2-[[2-(benzhydrylamino)-2-oxoacetyl]amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
| SMILES | CC(C)[C@H](NC(=O)C(=O)NC(c1ccccc1)c1ccccc1)C(=O)N[C@@H](CC(=O)O)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C31H29F4N3O7/c1-16(2)26(37-30(43)31(44)38-27(17-9-5-3-6-10-17)18-11-7-4-8-12-18)29(42)36-21(14-23(40)41)22(39)15-45-28-24(34)19(32)13-20(33)25(28)35/h3-13,16,21,26-27H,14-15H2,1-2H3,(H,36,42)(H,37,43)(H,38,44)(H,40,41)/t21-,26-/m0/s1 |
| InChIKey | KJKPUONOAGOHEL-LVXARBLLSA-N |
| XLogP | 3.20 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.58 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|