About 4-(4-bromo-5-chlorothiophen-2-yl)-4,4-difluoro-2,2-dimethylbutanoic acid
4-(4-bromo-5-chlorothiophen-2-yl)-4,4-difluoro-2,2-dimethylbutanoic acid (PubChem CID 102828988) has the molecular formula C10H10BrClF2O2S
and a molecular weight of 347.61 g/mol. Its IUPAC name is 4-(4-bromo-5-chlorothiophen-2-yl)-4,4-difluoro-2,2-dimethylbutanoic acid.
Molecular Properties
| Compound Name | 4-(4-bromo-5-chlorothiophen-2-yl)-4,4-difluoro-2,2-dimethylbutanoic acid |
| PubChem CID | 102828988 |
| Molecular Formula | C10H10BrClF2O2S |
| Molecular Weight | 347.61 g/mol |
| Exact Mass | 345.92 |
| IUPAC Name | 4-(4-bromo-5-chlorothiophen-2-yl)-4,4-difluoro-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(CC(F)(F)c1cc(Br)c(Cl)s1)C(=O)O |
| InChI | InChI=1S/C10H10BrClF2O2S/c1-9(2,8(15)16)4-10(13,14)6-3-5(11)7(12)17-6/h3H,4H2,1-2H3,(H,15,16) |
| InChIKey | CSOAHPDETXXMOQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-bromo-5-chlorothiophen-2-yl)-4,4-difluoro-2,2-dimethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromo-5-chlorothiophen-2-yl)-4,4-difluoro-2,2-dimethylbutanoic acid?
The IUPAC name of 4-(4-bromo-5-chlorothiophen-2-yl)-4,4-difluoro-2,2-dimethylbutanoic acid (CID 102828988) is 4-(4-bromo-5-chlorothiophen-2-yl)-4,4-difluoro-2,2-dimethylbutanoic acid.
What is the SMILES notation for 4-(4-bromo-5-chlorothiophen-2-yl)-4,4-difluoro-2,2-dimethylbutanoic acid?
The canonical SMILES for 4-(4-bromo-5-chlorothiophen-2-yl)-4,4-difluoro-2,2-dimethylbutanoic acid is CC(C)(CC(F)(F)c1cc(Br)c(Cl)s1)C(=O)O.
What is the InChIKey of 4-(4-bromo-5-chlorothiophen-2-yl)-4,4-difluoro-2,2-dimethylbutanoic acid?
The InChIKey is CSOAHPDETXXMOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrClF2O2S/c1-9(2,8(15)16)4-10(13,14)6-3-5(11)7(12)17-6/h3H,4H2,1-2H3,(H,15,16).
What are the key properties of 4-(4-bromo-5-chlorothiophen-2-yl)-4,4-difluoro-2,2-dimethylbutanoic acid?
4-(4-bromo-5-chlorothiophen-2-yl)-4,4-difluoro-2,2-dimethylbutanoic acid has a molecular weight of 347.61 g/mol, XLogP of 4.76, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromo-5-chlorothiophen-2-yl)-4,4-difluoro-2,2-dimethylbutanoic acid is sourced from PubChem (CID 102828988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).