C15H14N2OS — CID 102829330
(2-methylthiophen-3-yl)-(5-phenyl-1H-pyrazol-4-yl)methanol (PubChem CID 102829330) has the molecular formula C15H14N2OS and a molecular weight of 270.36 g/mol. Its IUPAC name is (2-methylthiophen-3-yl)-(5-phenyl-1H-pyrazol-4-yl)methanol.
| Compound Name | (2-methylthiophen-3-yl)-(5-phenyl-1H-pyrazol-4-yl)methanol |
|---|---|
| PubChem CID | 102829330 |
| Molecular Formula | C15H14N2OS |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | (2-methylthiophen-3-yl)-(5-phenyl-1H-pyrazol-4-yl)methanol |
| SMILES | Cc1sccc1C(O)c1cn[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C15H14N2OS/c1-10-12(7-8-19-10)15(18)13-9-16-17-14(13)11-5-3-2-4-6-11/h2-9,15,18H,1H3,(H,16,17) |
| InChIKey | FONHVVNEXBYTQQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |