About 5-amino-1-(2-methylthiophen-3-yl)-2,3-dihydroinden-1-ol
5-amino-1-(2-methylthiophen-3-yl)-2,3-dihydroinden-1-ol (PubChem CID 102829346) has the molecular formula C14H15NOS
and a molecular weight of 245.35 g/mol. Its IUPAC name is 5-amino-1-(2-methylthiophen-3-yl)-2,3-dihydroinden-1-ol.
Molecular Properties
| Compound Name | 5-amino-1-(2-methylthiophen-3-yl)-2,3-dihydroinden-1-ol |
| PubChem CID | 102829346 |
| Molecular Formula | C14H15NOS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 5-amino-1-(2-methylthiophen-3-yl)-2,3-dihydroinden-1-ol |
| SMILES | Cc1sccc1C1(O)CCc2cc(N)ccc21 |
| InChI | InChI=1S/C14H15NOS/c1-9-12(5-7-17-9)14(16)6-4-10-8-11(15)2-3-13(10)14/h2-3,5,7-8,16H,4,6,15H2,1H3 |
| InChIKey | HMZHLUWFIHIGEE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-1-(2-methylthiophen-3-yl)-2,3-dihydroinden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1-(2-methylthiophen-3-yl)-2,3-dihydroinden-1-ol?
The IUPAC name of 5-amino-1-(2-methylthiophen-3-yl)-2,3-dihydroinden-1-ol (CID 102829346) is 5-amino-1-(2-methylthiophen-3-yl)-2,3-dihydroinden-1-ol.
What is the SMILES notation for 5-amino-1-(2-methylthiophen-3-yl)-2,3-dihydroinden-1-ol?
The canonical SMILES for 5-amino-1-(2-methylthiophen-3-yl)-2,3-dihydroinden-1-ol is Cc1sccc1C1(O)CCc2cc(N)ccc21.
What is the InChIKey of 5-amino-1-(2-methylthiophen-3-yl)-2,3-dihydroinden-1-ol?
The InChIKey is HMZHLUWFIHIGEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NOS/c1-9-12(5-7-17-9)14(16)6-4-10-8-11(15)2-3-13(10)14/h2-3,5,7-8,16H,4,6,15H2,1H3.
What are the key properties of 5-amino-1-(2-methylthiophen-3-yl)-2,3-dihydroinden-1-ol?
5-amino-1-(2-methylthiophen-3-yl)-2,3-dihydroinden-1-ol has a molecular weight of 245.35 g/mol, XLogP of 2.82, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1-(2-methylthiophen-3-yl)-2,3-dihydroinden-1-ol is sourced from PubChem (CID 102829346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).