C14H18BrClN2OS — CID 102829914
1-(4-bromo-5-chlorothiophen-2-yl)-2-(1-pentan-3-ylpyrazol-3-yl)ethanol (PubChem CID 102829914) has the molecular formula C14H18BrClN2OS and a molecular weight of 377.74 g/mol. Its IUPAC name is 1-(4-bromo-5-chlorothiophen-2-yl)-2-(1-pentan-3-ylpyrazol-3-yl)ethanol.
| Compound Name | 1-(4-bromo-5-chlorothiophen-2-yl)-2-(1-pentan-3-ylpyrazol-3-yl)ethanol |
|---|---|
| PubChem CID | 102829914 |
| Molecular Formula | C14H18BrClN2OS |
| Molecular Weight | 377.74 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | 1-(4-bromo-5-chlorothiophen-2-yl)-2-(1-pentan-3-ylpyrazol-3-yl)ethanol |
| SMILES | CCC(CC)n1ccc(CC(O)c2cc(Br)c(Cl)s2)n1 |
| InChI | InChI=1S/C14H18BrClN2OS/c1-3-10(4-2)18-6-5-9(17-18)7-12(19)13-8-11(15)14(16)20-13/h5-6,8,10,12,19H,3-4,7H2,1-2H3 |
| InChIKey | DEQVQALAGPLFIC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.74 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |