C14H16BrNOS — CID 102830088
N-[(4-bromo-5-methylthiophen-2-yl)methyl]-4-ethoxyaniline (PubChem CID 102830088) has the molecular formula C14H16BrNOS and a molecular weight of 326.26 g/mol. Its IUPAC name is N-[(4-bromo-5-methylthiophen-2-yl)methyl]-4-ethoxyaniline.
| Compound Name | N-[(4-bromo-5-methylthiophen-2-yl)methyl]-4-ethoxyaniline |
|---|---|
| PubChem CID | 102830088 |
| Molecular Formula | C14H16BrNOS |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | N-[(4-bromo-5-methylthiophen-2-yl)methyl]-4-ethoxyaniline |
| SMILES | CCOc1ccc(NCc2cc(Br)c(C)s2)cc1 |
| InChI | InChI=1S/C14H16BrNOS/c1-3-17-12-6-4-11(5-7-12)16-9-13-8-14(15)10(2)18-13/h4-8,16H,3,9H2,1-2H3 |
| InChIKey | LPSKBDXXDMADNP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|