C34H40Cl2N6O3 — CID 10283075
3,5-dichloro-N-[(2Z)-2-methoxyimino-5-[4-(2-oxo-3-pyridin-2-yl-1,3-diazinan-1-yl)piperidin-1-yl]-3-phenylpentyl]-N-methylbenzamide (PubChem CID 10283075) has the molecular formula C34H40Cl2N6O3 and a molecular weight of 651.64 g/mol. Its IUPAC name is 3,5-dichloro-N-[(2Z)-2-methoxyimino-5-[4-(2-oxo-3-pyridin-2-yl-1,3-diazinan-1-yl)piperidin-1-yl]-3-phenylpentyl]-N-methylbenzamide.
| Compound Name | 3,5-dichloro-N-[(2Z)-2-methoxyimino-5-[4-(2-oxo-3-pyridin-2-yl-1,3-diazinan-1-yl)piperidin-1-yl]-3-phenylpentyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 10283075 |
| Molecular Formula | C34H40Cl2N6O3 |
| Molecular Weight | 651.64 g/mol |
| Exact Mass | 650.25 |
| IUPAC Name | 3,5-dichloro-N-[(2Z)-2-methoxyimino-5-[4-(2-oxo-3-pyridin-2-yl-1,3-diazinan-1-yl)piperidin-1-yl]-3-phenylpentyl]-N-methylbenzamide |
| SMILES | CO/N=C(\CN(C)C(=O)c1cc(Cl)cc(Cl)c1)C(CCN1CCC(N2CCCN(c3ccccn3)C2=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C34H40Cl2N6O3/c1-39(33(43)26-21-27(35)23-28(36)22-26)24-31(38-45-2)30(25-9-4-3-5-10-25)14-20-40-18-12-29(13-19-40)41-16-8-17-42(34(41)44)32-11-6-7-15-37-32/h3-7,9-11,15,21-23,29-30H,8,12-14,16-20,24H2,1-2H3/b38-31+ |
| InChIKey | KZHYAMWEMGMFNE-KPITYXSVSA-N |
| XLogP | 6.43 |
| TPSA | 81.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.64 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|