C40H53N5O3 — CID 10283086
[4-methyl-1-[8-(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)octyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 10283086) has the molecular formula C40H53N5O3 and a molecular weight of 651.90 g/mol. Its IUPAC name is [4-methyl-1-[8-(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)octyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [4-methyl-1-[8-(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)octyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 10283086 |
| Molecular Formula | C40H53N5O3 |
| Molecular Weight | 651.90 g/mol |
| Exact Mass | 651.41 |
| IUPAC Name | [4-methyl-1-[8-(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)octyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | CC1(OC(=O)Nc2ccccc2-c2ccccc2)CCN(CCCCCCCCN2CCC3(CC2)C(=O)NCN3c2ccccc2)CC1 |
| InChI | InChI=1S/C40H53N5O3/c1-39(48-38(47)42-36-21-13-12-20-35(36)33-16-8-6-9-17-33)22-28-43(29-23-39)26-14-4-2-3-5-15-27-44-30-24-40(25-31-44)37(46)41-32-45(40)34-18-10-7-11-19-34/h6-13,16-21H,2-5,14-15,22-32H2,1H3,(H,41,46)(H,42,47) |
| InChIKey | AHYUOLDSKBECJZ-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.90 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|