C8H9N3OS — CID 102831489
(2-methylthiophen-3-yl)-(2H-triazol-4-yl)methanol (PubChem CID 102831489) has the molecular formula C8H9N3OS and a molecular weight of 195.25 g/mol. Its IUPAC name is (2-methylthiophen-3-yl)-(2H-triazol-4-yl)methanol.
| Compound Name | (2-methylthiophen-3-yl)-(2H-triazol-4-yl)methanol |
|---|---|
| PubChem CID | 102831489 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | (2-methylthiophen-3-yl)-(2H-triazol-4-yl)methanol |
| SMILES | Cc1sccc1C(O)c1cn[nH]n1 |
| InChI | InChI=1S/C8H9N3OS/c1-5-6(2-3-13-5)8(12)7-4-9-11-10-7/h2-4,8,12H,1H3,(H,9,10,11) |
| InChIKey | WKTYZBNEQDFLHG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |