C12H11F2NS — CID 102831759
(3,4-difluorophenyl)-(2-methylthiophen-3-yl)methanamine (PubChem CID 102831759) has the molecular formula C12H11F2NS and a molecular weight of 239.29 g/mol. Its IUPAC name is (3,4-difluorophenyl)-(2-methylthiophen-3-yl)methanamine.
| Compound Name | (3,4-difluorophenyl)-(2-methylthiophen-3-yl)methanamine |
|---|---|
| PubChem CID | 102831759 |
| Molecular Formula | C12H11F2NS |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | (3,4-difluorophenyl)-(2-methylthiophen-3-yl)methanamine |
| SMILES | Cc1sccc1C(N)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H11F2NS/c1-7-9(4-5-16-7)12(15)8-2-3-10(13)11(14)6-8/h2-6,12H,15H2,1H3 |
| InChIKey | LZGNPQJWSONXFI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |