C12H19NS — CID 102832026
1-cyclopentyl-N-methyl-1-(2-methylthiophen-3-yl)methanamine (PubChem CID 102832026) has the molecular formula C12H19NS and a molecular weight of 209.36 g/mol. Its IUPAC name is 1-cyclopentyl-N-methyl-1-(2-methylthiophen-3-yl)methanamine.
| Compound Name | 1-cyclopentyl-N-methyl-1-(2-methylthiophen-3-yl)methanamine |
|---|---|
| PubChem CID | 102832026 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 1-cyclopentyl-N-methyl-1-(2-methylthiophen-3-yl)methanamine |
| SMILES | CNC(c1ccsc1C)C1CCCC1 |
| InChI | InChI=1S/C12H19NS/c1-9-11(7-8-14-9)12(13-2)10-5-3-4-6-10/h7-8,10,12-13H,3-6H2,1-2H3 |
| InChIKey | AIRKUSWXCWQUHQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |