C10H17NOS — CID 102832182
1-(2-methylthiophen-3-yl)-2-propoxyethanamine (PubChem CID 102832182) has the molecular formula C10H17NOS and a molecular weight of 199.32 g/mol. Its IUPAC name is 1-(2-methylthiophen-3-yl)-2-propoxyethanamine.
| Compound Name | 1-(2-methylthiophen-3-yl)-2-propoxyethanamine |
|---|---|
| PubChem CID | 102832182 |
| Molecular Formula | C10H17NOS |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 1-(2-methylthiophen-3-yl)-2-propoxyethanamine |
| SMILES | CCCOCC(N)c1ccsc1C |
| InChI | InChI=1S/C10H17NOS/c1-3-5-12-7-10(11)9-4-6-13-8(9)2/h4,6,10H,3,5,7,11H2,1-2H3 |
| InChIKey | CQZYDQQUEWYINR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|