C14H23NOS — CID 102833759
N-ethyl-1-(2-methylthiophen-3-yl)-2-(oxan-2-yl)ethanamine (PubChem CID 102833759) has the molecular formula C14H23NOS and a molecular weight of 253.41 g/mol. Its IUPAC name is N-ethyl-1-(2-methylthiophen-3-yl)-2-(oxan-2-yl)ethanamine.
| Compound Name | N-ethyl-1-(2-methylthiophen-3-yl)-2-(oxan-2-yl)ethanamine |
|---|---|
| PubChem CID | 102833759 |
| Molecular Formula | C14H23NOS |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | N-ethyl-1-(2-methylthiophen-3-yl)-2-(oxan-2-yl)ethanamine |
| SMILES | CCNC(CC1CCCCO1)c1ccsc1C |
| InChI | InChI=1S/C14H23NOS/c1-3-15-14(13-7-9-17-11(13)2)10-12-6-4-5-8-16-12/h7,9,12,14-15H,3-6,8,10H2,1-2H3 |
| InChIKey | CHMXEYPSAYGJNT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |