C16H20ClNS — CID 102834411
N-[1-[2-chloro-4-(2-methylthiophen-3-yl)phenyl]ethyl]propan-1-amine (PubChem CID 102834411) has the molecular formula C16H20ClNS and a molecular weight of 293.86 g/mol. Its IUPAC name is N-[1-[2-chloro-4-(2-methylthiophen-3-yl)phenyl]ethyl]propan-1-amine.
| Compound Name | N-[1-[2-chloro-4-(2-methylthiophen-3-yl)phenyl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 102834411 |
| Molecular Formula | C16H20ClNS |
| Molecular Weight | 293.86 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N-[1-[2-chloro-4-(2-methylthiophen-3-yl)phenyl]ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1ccc(-c2ccsc2C)cc1Cl |
| InChI | InChI=1S/C16H20ClNS/c1-4-8-18-11(2)14-6-5-13(10-16(14)17)15-7-9-19-12(15)3/h5-7,9-11,18H,4,8H2,1-3H3 |
| InChIKey | BMDORSGCTAMERQ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.86 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |