C14H16Br2N2S — CID 102838179
N-benzyl-1-(4,5-dibromothiophen-2-yl)-N-methylethane-1,2-diamine (PubChem CID 102838179) has the molecular formula C14H16Br2N2S and a molecular weight of 404.17 g/mol. Its IUPAC name is N-benzyl-1-(4,5-dibromothiophen-2-yl)-N-methylethane-1,2-diamine.
| Compound Name | N-benzyl-1-(4,5-dibromothiophen-2-yl)-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 102838179 |
| Molecular Formula | C14H16Br2N2S |
| Molecular Weight | 404.17 g/mol |
| Exact Mass | 401.94 |
| IUPAC Name | N-benzyl-1-(4,5-dibromothiophen-2-yl)-N-methylethane-1,2-diamine |
| SMILES | CN(Cc1ccccc1)C(CN)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C14H16Br2N2S/c1-18(9-10-5-3-2-4-6-10)12(8-17)13-7-11(15)14(16)19-13/h2-7,12H,8-9,17H2,1H3 |
| InChIKey | NLLRYGLTIATOHM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.17 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |