About 1-(4-bromo-5-chlorothiophen-2-yl)-N-(2,2-difluoroethyl)ethane-1,2-diamine
1-(4-bromo-5-chlorothiophen-2-yl)-N-(2,2-difluoroethyl)ethane-1,2-diamine (PubChem CID 102839801) has the molecular formula C8H10BrClF2N2S
and a molecular weight of 319.60 g/mol. Its IUPAC name is 1-(4-bromo-5-chlorothiophen-2-yl)-N-(2,2-difluoroethyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-(4-bromo-5-chlorothiophen-2-yl)-N-(2,2-difluoroethyl)ethane-1,2-diamine |
| PubChem CID | 102839801 |
| Molecular Formula | C8H10BrClF2N2S |
| Molecular Weight | 319.60 g/mol |
| Exact Mass | 317.94 |
| IUPAC Name | 1-(4-bromo-5-chlorothiophen-2-yl)-N-(2,2-difluoroethyl)ethane-1,2-diamine |
| SMILES | NCC(NCC(F)F)c1cc(Br)c(Cl)s1 |
| InChI | InChI=1S/C8H10BrClF2N2S/c9-4-1-6(15-8(4)10)5(2-13)14-3-7(11)12/h1,5,7,14H,2-3,13H2 |
| InChIKey | LEEXLZKHVNPREY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.60 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-bromo-5-chlorothiophen-2-yl)-N-(2,2-difluoroethyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-bromo-5-chlorothiophen-2-yl)-N-(2,2-difluoroethyl)ethane-1,2-diamine?
The IUPAC name of 1-(4-bromo-5-chlorothiophen-2-yl)-N-(2,2-difluoroethyl)ethane-1,2-diamine (CID 102839801) is 1-(4-bromo-5-chlorothiophen-2-yl)-N-(2,2-difluoroethyl)ethane-1,2-diamine.
What is the SMILES notation for 1-(4-bromo-5-chlorothiophen-2-yl)-N-(2,2-difluoroethyl)ethane-1,2-diamine?
The canonical SMILES for 1-(4-bromo-5-chlorothiophen-2-yl)-N-(2,2-difluoroethyl)ethane-1,2-diamine is NCC(NCC(F)F)c1cc(Br)c(Cl)s1.
What is the InChIKey of 1-(4-bromo-5-chlorothiophen-2-yl)-N-(2,2-difluoroethyl)ethane-1,2-diamine?
The InChIKey is LEEXLZKHVNPREY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BrClF2N2S/c9-4-1-6(15-8(4)10)5(2-13)14-3-7(11)12/h1,5,7,14H,2-3,13H2.
What are the key properties of 1-(4-bromo-5-chlorothiophen-2-yl)-N-(2,2-difluoroethyl)ethane-1,2-diamine?
1-(4-bromo-5-chlorothiophen-2-yl)-N-(2,2-difluoroethyl)ethane-1,2-diamine has a molecular weight of 319.60 g/mol, XLogP of 3.02, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-bromo-5-chlorothiophen-2-yl)-N-(2,2-difluoroethyl)ethane-1,2-diamine is sourced from PubChem (CID 102839801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).