C13H10Br2ClNO2S — CID 102840709
methyl 2-(2-chloroanilino)-2-(4,5-dibromothiophen-2-yl)acetate (PubChem CID 102840709) has the molecular formula C13H10Br2ClNO2S and a molecular weight of 439.56 g/mol. Its IUPAC name is methyl 2-(2-chloroanilino)-2-(4,5-dibromothiophen-2-yl)acetate.
| Compound Name | methyl 2-(2-chloroanilino)-2-(4,5-dibromothiophen-2-yl)acetate |
|---|---|
| PubChem CID | 102840709 |
| Molecular Formula | C13H10Br2ClNO2S |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 436.85 |
| IUPAC Name | methyl 2-(2-chloroanilino)-2-(4,5-dibromothiophen-2-yl)acetate |
| SMILES | COC(=O)C(Nc1ccccc1Cl)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C13H10Br2ClNO2S/c1-19-13(18)11(10-6-7(14)12(15)20-10)17-9-5-3-2-4-8(9)16/h2-6,11,17H,1H3 |
| InChIKey | MUTXJRMMDHPQMM-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |