C11H15N3S2 — CID 102840891
N-[(2-methylthiophen-3-yl)-(thiadiazol-5-yl)methyl]propan-1-amine (PubChem CID 102840891) has the molecular formula C11H15N3S2 and a molecular weight of 253.40 g/mol. Its IUPAC name is N-[(2-methylthiophen-3-yl)-(thiadiazol-5-yl)methyl]propan-1-amine.
| Compound Name | N-[(2-methylthiophen-3-yl)-(thiadiazol-5-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 102840891 |
| Molecular Formula | C11H15N3S2 |
| Molecular Weight | 253.40 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | N-[(2-methylthiophen-3-yl)-(thiadiazol-5-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cnns1)c1ccsc1C |
| InChI | InChI=1S/C11H15N3S2/c1-3-5-12-11(10-7-13-14-16-10)9-4-6-15-8(9)2/h4,6-7,11-12H,3,5H2,1-2H3 |
| InChIKey | LMPXOCQWGYNYFX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |