C14H11Br2NO4S — CID 102841122
2-(4,5-dibromothiophen-2-yl)-2-(phenylmethoxycarbonylamino)acetic acid (PubChem CID 102841122) has the molecular formula C14H11Br2NO4S and a molecular weight of 449.12 g/mol. Its IUPAC name is 2-(4,5-dibromothiophen-2-yl)-2-(phenylmethoxycarbonylamino)acetic acid.
| Compound Name | 2-(4,5-dibromothiophen-2-yl)-2-(phenylmethoxycarbonylamino)acetic acid |
|---|---|
| PubChem CID | 102841122 |
| Molecular Formula | C14H11Br2NO4S |
| Molecular Weight | 449.12 g/mol |
| Exact Mass | 446.88 |
| IUPAC Name | 2-(4,5-dibromothiophen-2-yl)-2-(phenylmethoxycarbonylamino)acetic acid |
| SMILES | O=C(NC(C(=O)O)c1cc(Br)c(Br)s1)OCc1ccccc1 |
| InChI | InChI=1S/C14H11Br2NO4S/c15-9-6-10(22-12(9)16)11(13(18)19)17-14(20)21-7-8-4-2-1-3-5-8/h1-6,11H,7H2,(H,17,20)(H,18,19) |
| InChIKey | RPZGGDQHGJWRQJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.12 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |