About ethyl 1-[(4,5-dibromothiophen-2-yl)methyl]piperazine-2-carboxylate
ethyl 1-[(4,5-dibromothiophen-2-yl)methyl]piperazine-2-carboxylate (PubChem CID 102841745) has the molecular formula C12H16Br2N2O2S
and a molecular weight of 412.15 g/mol. Its IUPAC name is ethyl 1-[(4,5-dibromothiophen-2-yl)methyl]piperazine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[(4,5-dibromothiophen-2-yl)methyl]piperazine-2-carboxylate |
| PubChem CID | 102841745 |
| Molecular Formula | C12H16Br2N2O2S |
| Molecular Weight | 412.15 g/mol |
| Exact Mass | 409.93 |
| IUPAC Name | ethyl 1-[(4,5-dibromothiophen-2-yl)methyl]piperazine-2-carboxylate |
| SMILES | CCOC(=O)C1CNCCN1Cc1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C12H16Br2N2O2S/c1-2-18-12(17)10-6-15-3-4-16(10)7-8-5-9(13)11(14)19-8/h5,10,15H,2-4,6-7H2,1H3 |
| InChIKey | LJPKIDUWFKVFHM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.15 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1-[(4,5-dibromothiophen-2-yl)methyl]piperazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[(4,5-dibromothiophen-2-yl)methyl]piperazine-2-carboxylate?
The IUPAC name of ethyl 1-[(4,5-dibromothiophen-2-yl)methyl]piperazine-2-carboxylate (CID 102841745) is ethyl 1-[(4,5-dibromothiophen-2-yl)methyl]piperazine-2-carboxylate.
What is the SMILES notation for ethyl 1-[(4,5-dibromothiophen-2-yl)methyl]piperazine-2-carboxylate?
The canonical SMILES for ethyl 1-[(4,5-dibromothiophen-2-yl)methyl]piperazine-2-carboxylate is CCOC(=O)C1CNCCN1Cc1cc(Br)c(Br)s1.
What is the InChIKey of ethyl 1-[(4,5-dibromothiophen-2-yl)methyl]piperazine-2-carboxylate?
The InChIKey is LJPKIDUWFKVFHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16Br2N2O2S/c1-2-18-12(17)10-6-15-3-4-16(10)7-8-5-9(13)11(14)19-8/h5,10,15H,2-4,6-7H2,1H3.
What are the key properties of ethyl 1-[(4,5-dibromothiophen-2-yl)methyl]piperazine-2-carboxylate?
ethyl 1-[(4,5-dibromothiophen-2-yl)methyl]piperazine-2-carboxylate has a molecular weight of 412.15 g/mol, XLogP of 2.61, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[(4,5-dibromothiophen-2-yl)methyl]piperazine-2-carboxylate is sourced from PubChem (CID 102841745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).