C13H23NS — CID 102841988
N,2-diethyl-1-(2-methylthiophen-3-yl)butan-1-amine (PubChem CID 102841988) has the molecular formula C13H23NS and a molecular weight of 225.40 g/mol. Its IUPAC name is N,2-diethyl-1-(2-methylthiophen-3-yl)butan-1-amine.
| Compound Name | N,2-diethyl-1-(2-methylthiophen-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 102841988 |
| Molecular Formula | C13H23NS |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | N,2-diethyl-1-(2-methylthiophen-3-yl)butan-1-amine |
| SMILES | CCNC(c1ccsc1C)C(CC)CC |
| InChI | InChI=1S/C13H23NS/c1-5-11(6-2)13(14-7-3)12-8-9-15-10(12)4/h8-9,11,13-14H,5-7H2,1-4H3 |
| InChIKey | SLUNBULEGBNIAA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |