C13H19N3S2 — CID 102842118
N-[(2-methylthiophen-3-yl)-(4-propylthiadiazol-5-yl)methyl]ethanamine (PubChem CID 102842118) has the molecular formula C13H19N3S2 and a molecular weight of 281.45 g/mol. Its IUPAC name is N-[(2-methylthiophen-3-yl)-(4-propylthiadiazol-5-yl)methyl]ethanamine.
| Compound Name | N-[(2-methylthiophen-3-yl)-(4-propylthiadiazol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 102842118 |
| Molecular Formula | C13H19N3S2 |
| Molecular Weight | 281.45 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | N-[(2-methylthiophen-3-yl)-(4-propylthiadiazol-5-yl)methyl]ethanamine |
| SMILES | CCCc1nnsc1C(NCC)c1ccsc1C |
| InChI | InChI=1S/C13H19N3S2/c1-4-6-11-13(18-16-15-11)12(14-5-2)10-7-8-17-9(10)3/h7-8,12,14H,4-6H2,1-3H3 |
| InChIKey | HAFMSNMXIHMFGJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |