C8H12BrNOS — CID 102845248
2-(4-bromo-5-methylthiophen-2-yl)-2-methoxyethanamine (PubChem CID 102845248) has the molecular formula C8H12BrNOS and a molecular weight of 250.16 g/mol. Its IUPAC name is 2-(4-bromo-5-methylthiophen-2-yl)-2-methoxyethanamine.
| Compound Name | 2-(4-bromo-5-methylthiophen-2-yl)-2-methoxyethanamine |
|---|---|
| PubChem CID | 102845248 |
| Molecular Formula | C8H12BrNOS |
| Molecular Weight | 250.16 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | 2-(4-bromo-5-methylthiophen-2-yl)-2-methoxyethanamine |
| SMILES | COC(CN)c1cc(Br)c(C)s1 |
| InChI | InChI=1S/C8H12BrNOS/c1-5-6(9)3-8(12-5)7(4-10)11-2/h3,7H,4,10H2,1-2H3 |
| InChIKey | HCQVYUCLFBIBCK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.16 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |