C13H19Br2NOS — CID 102845700
N-[[2-(4,5-dibromothiophen-2-yl)oxan-3-yl]methyl]propan-1-amine (PubChem CID 102845700) has the molecular formula C13H19Br2NOS and a molecular weight of 397.18 g/mol. Its IUPAC name is N-[[2-(4,5-dibromothiophen-2-yl)oxan-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(4,5-dibromothiophen-2-yl)oxan-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 102845700 |
| Molecular Formula | C13H19Br2NOS |
| Molecular Weight | 397.18 g/mol |
| Exact Mass | 394.96 |
| IUPAC Name | N-[[2-(4,5-dibromothiophen-2-yl)oxan-3-yl]methyl]propan-1-amine |
| SMILES | CCCNCC1CCCOC1c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C13H19Br2NOS/c1-2-5-16-8-9-4-3-6-17-12(9)11-7-10(14)13(15)18-11/h7,9,12,16H,2-6,8H2,1H3 |
| InChIKey | JASVDSHOWYLWFU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.18 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|