C14H13Br2N3S — CID 102845733
1-benzyl-5-(4,5-dibromothiophen-2-yl)-4,5-dihydroimidazol-2-amine (PubChem CID 102845733) has the molecular formula C14H13Br2N3S and a molecular weight of 415.15 g/mol. Its IUPAC name is 1-benzyl-5-(4,5-dibromothiophen-2-yl)-4,5-dihydroimidazol-2-amine.
| Compound Name | 1-benzyl-5-(4,5-dibromothiophen-2-yl)-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 102845733 |
| Molecular Formula | C14H13Br2N3S |
| Molecular Weight | 415.15 g/mol |
| Exact Mass | 412.92 |
| IUPAC Name | 1-benzyl-5-(4,5-dibromothiophen-2-yl)-4,5-dihydroimidazol-2-amine |
| SMILES | NC1=NCC(c2cc(Br)c(Br)s2)N1Cc1ccccc1 |
| InChI | InChI=1S/C14H13Br2N3S/c15-10-6-12(20-13(10)16)11-7-18-14(17)19(11)8-9-4-2-1-3-5-9/h1-6,11H,7-8H2,(H2,17,18) |
| InChIKey | QNQJOKUUZRENAM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.15 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |