About 3-prop-2-ynoxyquinoline
3-prop-2-ynoxyquinoline (PubChem CID 102847055) has the molecular formula C12H9NO
and a molecular weight of 183.21 g/mol. Its IUPAC name is 3-prop-2-ynoxyquinoline.
Molecular Properties
| Compound Name | 3-prop-2-ynoxyquinoline |
| PubChem CID | 102847055 |
| Molecular Formula | C12H9NO |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 3-prop-2-ynoxyquinoline |
| SMILES | C#CCOc1cnc2ccccc2c1 |
| InChI | InChI=1S/C12H9NO/c1-2-7-14-11-8-10-5-3-4-6-12(10)13-9-11/h1,3-6,8-9H,7H2 |
| InChIKey | KLMYEDYIYGTOQG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-2-ynoxyquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-2-ynoxyquinoline?
The IUPAC name of 3-prop-2-ynoxyquinoline (CID 102847055) is 3-prop-2-ynoxyquinoline.
What is the SMILES notation for 3-prop-2-ynoxyquinoline?
The canonical SMILES for 3-prop-2-ynoxyquinoline is C#CCOc1cnc2ccccc2c1.
What is the InChIKey of 3-prop-2-ynoxyquinoline?
The InChIKey is KLMYEDYIYGTOQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO/c1-2-7-14-11-8-10-5-3-4-6-12(10)13-9-11/h1,3-6,8-9H,7H2.
What are the key properties of 3-prop-2-ynoxyquinoline?
3-prop-2-ynoxyquinoline has a molecular weight of 183.21 g/mol, XLogP of 2.25, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-2-ynoxyquinoline is sourced from PubChem (CID 102847055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).