C16H20ClNOS — CID 102848299
3-[(3-chloro-1-benzothiophen-2-yl)methyl-cyclobutylamino]propan-1-ol (PubChem CID 102848299) has the molecular formula C16H20ClNOS and a molecular weight of 309.86 g/mol. Its IUPAC name is 3-[(3-chloro-1-benzothiophen-2-yl)methyl-cyclobutylamino]propan-1-ol.
| Compound Name | 3-[(3-chloro-1-benzothiophen-2-yl)methyl-cyclobutylamino]propan-1-ol |
|---|---|
| PubChem CID | 102848299 |
| Molecular Formula | C16H20ClNOS |
| Molecular Weight | 309.86 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 3-[(3-chloro-1-benzothiophen-2-yl)methyl-cyclobutylamino]propan-1-ol |
| SMILES | OCCCN(Cc1sc2ccccc2c1Cl)C1CCC1 |
| InChI | InChI=1S/C16H20ClNOS/c17-16-13-7-1-2-8-14(13)20-15(16)11-18(9-4-10-19)12-5-3-6-12/h1-2,7-8,12,19H,3-6,9-11H2 |
| InChIKey | IKGKPNJADKRURI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.86 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |